Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Cesium sulfate, 99.95% (metals basis)
CAS: 10294-54-9 Molecular Formula: Cs2O4S Molecular Weight (g/mol): 361.87 MDL Number: MFCD00010959 InChI Key: FLJPGEWQYJVDPF-UHFFFAOYSA-L Synonym: cesium sulfate,dicesium sulfate,sulfuric acid, dicesium salt,caesium sulphate,caesium sulfate,unii-8d6r91cs62,dicaesium 1+ ion sulfate,cesiumsulfate,dicaesium 1+ sulfate PubChem CID: 25137 SMILES: [Cs+].[Cs+].[O-]S([O-])(=O)=O
| PubChem CID | 25137 |
|---|---|
| CAS | 10294-54-9 |
| Molecular Weight (g/mol) | 361.87 |
| MDL Number | MFCD00010959 |
| SMILES | [Cs+].[Cs+].[O-]S([O-])(=O)=O |
| Synonym | cesium sulfate,dicesium sulfate,sulfuric acid, dicesium salt,caesium sulphate,caesium sulfate,unii-8d6r91cs62,dicaesium 1+ ion sulfate,cesiumsulfate,dicaesium 1+ sulfate |
| InChI Key | FLJPGEWQYJVDPF-UHFFFAOYSA-L |
| Molecular Formula | Cs2O4S |
Holmium(III) oxide, REacton™, 99.995% (REO)
CAS: 12055-62-8 Molecular Formula: Ho2O3 Molecular Weight (g/mol): 377.86 MDL Number: MFCD00011053 InChI Key: OWCYYNSBGXMRQN-UHFFFAOYSA-N IUPAC Name: diholmium(3+) trioxidandiide SMILES: [O--].[O--].[O--].[Ho+3].[Ho+3]
| CAS | 12055-62-8 |
|---|---|
| Molecular Weight (g/mol) | 377.86 |
| MDL Number | MFCD00011053 |
| SMILES | [O--].[O--].[O--].[Ho+3].[Ho+3] |
| IUPAC Name | diholmium(3+) trioxidandiide |
| InChI Key | OWCYYNSBGXMRQN-UHFFFAOYSA-N |
| Molecular Formula | Ho2O3 |
Cadmium carbonate, Puratronic™, 99.998% (metals basis)
CAS: 513-78-0 Molecular Formula: CCdO3 Molecular Weight (g/mol): 172.42 MDL Number: MFCD00010918 InChI Key: GKDXQAKPHKQZSC-UHFFFAOYSA-L Synonym: cadmium carbonate,mikrokalcit,otavite,kalcit,supermikrokalcit,carbonic acid, cadmium salt 1:1,cadmium monocarbonate,chemcarb cdco3,caswell no. 134a,unii-616zvs3bly PubChem CID: 10564 IUPAC Name: cadmium(2+);carbonate SMILES: [Cd++].[O-]C([O-])=O
| PubChem CID | 10564 |
|---|---|
| CAS | 513-78-0 |
| Molecular Weight (g/mol) | 172.42 |
| MDL Number | MFCD00010918 |
| SMILES | [Cd++].[O-]C([O-])=O |
| Synonym | cadmium carbonate,mikrokalcit,otavite,kalcit,supermikrokalcit,carbonic acid, cadmium salt 1:1,cadmium monocarbonate,chemcarb cdco3,caswell no. 134a,unii-616zvs3bly |
| IUPAC Name | cadmium(2+);carbonate |
| InChI Key | GKDXQAKPHKQZSC-UHFFFAOYSA-L |
| Molecular Formula | CCdO3 |
Iridium wire, 0.25mm (0.01in) dia, 99.8% (metals basis)
CAS: 7439-88-5 Molecular Formula: Ir Molecular Weight (g/mol): 192.22 MDL Number: MFCD00011062 InChI Key: GKOZUEZYRPOHIO-UHFFFAOYSA-N Synonym: ion,black,metallicum,iridium, elemental,iridium, ion ir4,iridio,hydrido-iridium,atom,powder,sponge PubChem CID: 23924 ChEBI: CHEBI:49666 IUPAC Name: iridium SMILES: [Ir]
| PubChem CID | 23924 |
|---|---|
| CAS | 7439-88-5 |
| Molecular Weight (g/mol) | 192.22 |
| ChEBI | CHEBI:49666 |
| MDL Number | MFCD00011062 |
| SMILES | [Ir] |
| Synonym | ion,black,metallicum,iridium, elemental,iridium, ion ir4,iridio,hydrido-iridium,atom,powder,sponge |
| IUPAC Name | iridium |
| InChI Key | GKOZUEZYRPOHIO-UHFFFAOYSA-N |
| Molecular Formula | Ir |
Ammonium Sulfate, Crystal, Reagent, ACS, 99%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 7783-20-2 Molecular Formula: H8N2O4S Molecular Weight (g/mol): 132.13 MDL Number: MFCD00003391 InChI Key: BFNBIHQBYMNNAN-UHFFFAOYSA-N IUPAC Name: sulfuric acid diamine SMILES: N.N.OS(O)(=O)=O
| CAS | 7783-20-2 |
|---|---|
| Molecular Weight (g/mol) | 132.13 |
| MDL Number | MFCD00003391 |
| SMILES | N.N.OS(O)(=O)=O |
| IUPAC Name | sulfuric acid diamine |
| InChI Key | BFNBIHQBYMNNAN-UHFFFAOYSA-N |
| Molecular Formula | H8N2O4S |
Ammonium Hydroxide, 6.0 N Solution, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 1336-21-6 Molecular Formula: H5NO Molecular Weight (g/mol): 35.05 MDL Number: MFCD00066650 InChI Key: VHUUQVKOLVNVRT-UHFFFAOYSA-N IUPAC Name: amine hydrate SMILES: N.O
| CAS | 1336-21-6 |
|---|---|
| Molecular Weight (g/mol) | 35.05 |
| MDL Number | MFCD00066650 |
| SMILES | N.O |
| IUPAC Name | amine hydrate |
| InChI Key | VHUUQVKOLVNVRT-UHFFFAOYSA-N |
| Molecular Formula | H5NO |
Dysprosium foil, 0.62mm (0.024in) thick, 99.8% (REO)
CAS: 7429-91-6 Molecular Formula: Dy Molecular Weight (g/mol): 162.50 MDL Number: MFCD00010982 InChI Key: KBQHZAAAGSGFKK-UHFFFAOYSA-N Synonym: ingot reo,disprosio,atom,ion,ingot,pieces,powder,foil, 3n,chips, 3n,ingot, 3n PubChem CID: 23912 ChEBI: CHEBI:33377 IUPAC Name: dysprosium SMILES: [Dy]
| PubChem CID | 23912 |
|---|---|
| CAS | 7429-91-6 |
| Molecular Weight (g/mol) | 162.50 |
| ChEBI | CHEBI:33377 |
| MDL Number | MFCD00010982 |
| SMILES | [Dy] |
| Synonym | ingot reo,disprosio,atom,ion,ingot,pieces,powder,foil, 3n,chips, 3n,ingot, 3n |
| IUPAC Name | dysprosium |
| InChI Key | KBQHZAAAGSGFKK-UHFFFAOYSA-N |
| Molecular Formula | Dy |
Antimony shot, 1.5-5mm (0.06-0.2in), Puratronic™, 99.9999% (metals basis)
CAS: 7440-36-0 Molecular Formula: Sb Molecular Weight (g/mol): 121.76 MDL Number: MFCD00011211 MFCD00134030 InChI Key: WATWJIUSRGPENY-UHFFFAOYSA-N Synonym: powder,stibium metallicum,antimony, metallic,antimony, elemental,stibanylidyne,unii-9it35j3uv3,antymonowodor polish,unii-0vkz97k3ub,0vkz97k3ub,antimonwasserstoffes german PubChem CID: 5354495 ChEBI: CHEBI:30304 SMILES: [Sb]
| PubChem CID | 5354495 |
|---|---|
| CAS | 7440-36-0 |
| Molecular Weight (g/mol) | 121.76 |
| ChEBI | CHEBI:30304 |
| MDL Number | MFCD00011211 MFCD00134030 |
| SMILES | [Sb] |
| Synonym | powder,stibium metallicum,antimony, metallic,antimony, elemental,stibanylidyne,unii-9it35j3uv3,antymonowodor polish,unii-0vkz97k3ub,0vkz97k3ub,antimonwasserstoffes german |
| InChI Key | WATWJIUSRGPENY-UHFFFAOYSA-N |
| Molecular Formula | Sb |
Gold wire, 0.1mm (0.004in) dia, Premion™, 99.998% (metals basis)
CAS: 7440-57-5 Molecular Formula: Au Molecular Weight (g/mol): 196.97 MDL Number: MFCD00003436 InChI Key: PCHJSUWPFVWCPO-UHFFFAOYSA-N Synonym: colloidal,powder,flake,leaf,gold, colloidal,burnish,shell,ci pigment metal 3,magnesium purple,c.i. pigment metal 3 PubChem CID: 23985 ChEBI: CHEBI:30050 IUPAC Name: gold SMILES: [Au]
| PubChem CID | 23985 |
|---|---|
| CAS | 7440-57-5 |
| Molecular Weight (g/mol) | 196.97 |
| ChEBI | CHEBI:30050 |
| MDL Number | MFCD00003436 |
| SMILES | [Au] |
| Synonym | colloidal,powder,flake,leaf,gold, colloidal,burnish,shell,ci pigment metal 3,magnesium purple,c.i. pigment metal 3 |
| IUPAC Name | gold |
| InChI Key | PCHJSUWPFVWCPO-UHFFFAOYSA-N |
| Molecular Formula | Au |
Mercury(II) chloride, Puratronic™, 99.999% (metals basis)
CAS: 7487-94-7 Molecular Formula: Cl2Hg Molecular Weight (g/mol): 271.49 MDL Number: MFCD00011041 InChI Key: LWJROJCJINYWOX-UHFFFAOYSA-L Synonym: mercuric chloride,mercury ii chloride,sublimate,mercury bichloride,mercury dichloride,corrosive sublimate,mercuric bichloride,mercury perchloride,sublimat,hgcl2 PubChem CID: 24085 ChEBI: CHEBI:31823 SMILES: [Cl-].[Cl-].[Hg++]
| PubChem CID | 24085 |
|---|---|
| CAS | 7487-94-7 |
| Molecular Weight (g/mol) | 271.49 |
| ChEBI | CHEBI:31823 |
| MDL Number | MFCD00011041 |
| SMILES | [Cl-].[Cl-].[Hg++] |
| Synonym | mercuric chloride,mercury ii chloride,sublimate,mercury bichloride,mercury dichloride,corrosive sublimate,mercuric bichloride,mercury perchloride,sublimat,hgcl2 |
| InChI Key | LWJROJCJINYWOX-UHFFFAOYSA-L |
| Molecular Formula | Cl2Hg |
Vanadium(V) oxide, 99.99% (metals basis)
CAS: 1314-62-1 Molecular Formula: O5V2 Molecular Weight (g/mol): 181.88 MDL Number: MFCD00011457 InChI Key: GNTDGMZSJNCJKK-UHFFFAOYSA-N Synonym: vanadium v oxide,vanadium pentoxide,divanadium pentaoxide,divanadium pentoxide,vanadic anhydride,vanadin v oxide,vanadium oxide v2o5,vanadium pentaoxide,vanadic acid anhydride PubChem CID: 14814 ChEBI: CHEBI:30045 SMILES: O=[V](=O)O[V](=O)=O
| PubChem CID | 14814 |
|---|---|
| CAS | 1314-62-1 |
| Molecular Weight (g/mol) | 181.88 |
| ChEBI | CHEBI:30045 |
| MDL Number | MFCD00011457 |
| SMILES | O=[V](=O)O[V](=O)=O |
| Synonym | vanadium v oxide,vanadium pentoxide,divanadium pentaoxide,divanadium pentoxide,vanadic anhydride,vanadin v oxide,vanadium oxide v2o5,vanadium pentaoxide,vanadic acid anhydride |
| InChI Key | GNTDGMZSJNCJKK-UHFFFAOYSA-N |
| Molecular Formula | O5V2 |
Nickel wire, 0.1mm (0.004in) dia, Puratronic™, 99.994% (metals basis)
CAS: 7440-02-0 Molecular Formula: Ni Molecular Weight (g/mol): 58.69 MDL Number: MFCD00011137 MFCD06798735 InChI Key: PXHVJJICTQNCMI-UHFFFAOYSA-N Synonym: raney alloy,fibrex,catalyst,particles,fibrex p,nickel, elemental,nichel italian,nickel, soluble salts,carbonyl powder,niccolum PubChem CID: 935 ChEBI: CHEBI:28112 IUPAC Name: nickel SMILES: [Ni]
| PubChem CID | 935 |
|---|---|
| CAS | 7440-02-0 |
| Molecular Weight (g/mol) | 58.69 |
| ChEBI | CHEBI:28112 |
| MDL Number | MFCD00011137 MFCD06798735 |
| SMILES | [Ni] |
| Synonym | raney alloy,fibrex,catalyst,particles,fibrex p,nickel, elemental,nichel italian,nickel, soluble salts,carbonyl powder,niccolum |
| IUPAC Name | nickel |
| InChI Key | PXHVJJICTQNCMI-UHFFFAOYSA-N |
| Molecular Formula | Ni |
Iron(III) oxide, Puratronic™, 99.995% (metals basis), Thermo Scientific Chemicals
CAS: 1309-37-1 Molecular Formula: Fe2O3 Molecular Weight (g/mol): 159.69 MDL Number: MFCD00011008 InChI Key: JEIPFZHSYJVQDO-UHFFFAOYSA-N IUPAC Name: trioxodiiron SMILES: [Fe][Fe](=O)(=O)=O
| CAS | 1309-37-1 |
|---|---|
| Molecular Weight (g/mol) | 159.69 |
| MDL Number | MFCD00011008 |
| SMILES | [Fe][Fe](=O)(=O)=O |
| IUPAC Name | trioxodiiron |
| InChI Key | JEIPFZHSYJVQDO-UHFFFAOYSA-N |
| Molecular Formula | Fe2O3 |
Sodium hexafluoroantimonate(V), 99.5%
CAS: 16925-25-0 Molecular Formula: F6NaSb Molecular Weight (g/mol): 258.74 MDL Number: MFCD00003482 InChI Key: HKLMYZVMEYYVBS-UHFFFAOYSA-H Synonym: sodium hexafluoroantimonate,sodium hexafluoroantimonate v,sodium hexafluorostibanuide,sodium hexafluoro antimonate,antimony sodium fluoride,f6sb.na,nasbf6,acmc-20ajo7,sodium hexafluorostiboranuide,hexafluorostibine, sodium salt PubChem CID: 16689647 IUPAC Name: sodium;hexafluoroantimony(1-) SMILES: F[Sb-](F)(F)(F)(F)F.[Na+]
| PubChem CID | 16689647 |
|---|---|
| CAS | 16925-25-0 |
| Molecular Weight (g/mol) | 258.74 |
| MDL Number | MFCD00003482 |
| SMILES | F[Sb-](F)(F)(F)(F)F.[Na+] |
| Synonym | sodium hexafluoroantimonate,sodium hexafluoroantimonate v,sodium hexafluorostibanuide,sodium hexafluoro antimonate,antimony sodium fluoride,f6sb.na,nasbf6,acmc-20ajo7,sodium hexafluorostiboranuide,hexafluorostibine, sodium salt |
| IUPAC Name | sodium;hexafluoroantimony(1-) |
| InChI Key | HKLMYZVMEYYVBS-UHFFFAOYSA-H |
| Molecular Formula | F6NaSb |
Sodium Bicarbonate, 99.5%-100.0%, (Crystalline powder/ACS Reagent Grade), MP Biomedicals
CAS: 144-55-8 Molecular Formula: CHNaO3 Molecular Weight (g/mol): 84.01 MDL Number: MFCD00003528 InChI Key: UIIMBOGNXHQVGW-UHFFFAOYSA-M Synonym: sodium bicarbonate,sodium hydrogen carbonate,baking soda,carbonic acid monosodium salt,sodium acid carbonate,bicarbonate of soda,sodium hydrogencarbonate,meylon,acidosan,neut PubChem CID: 516892 ChEBI: CHEBI:32139 IUPAC Name: sodium hydrogen carbonate SMILES: [Na+].OC([O-])=O
| PubChem CID | 516892 |
|---|---|
| CAS | 144-55-8 |
| Molecular Weight (g/mol) | 84.01 |
| ChEBI | CHEBI:32139 |
| MDL Number | MFCD00003528 |
| SMILES | [Na+].OC([O-])=O |
| Synonym | sodium bicarbonate,sodium hydrogen carbonate,baking soda,carbonic acid monosodium salt,sodium acid carbonate,bicarbonate of soda,sodium hydrogencarbonate,meylon,acidosan,neut |
| IUPAC Name | sodium hydrogen carbonate |
| InChI Key | UIIMBOGNXHQVGW-UHFFFAOYSA-M |
| Molecular Formula | CHNaO3 |